C16H23N3O2 — CID 143066121
ethane;2,2,4,8-tetramethyl-3,4-dihydrochromene-6-carbonyl azide (PubChem CID 143066121) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethane;2,2,4,8-tetramethyl-3,4-dihydrochromene-6-carbonyl azide.
| Compound Name | ethane;2,2,4,8-tetramethyl-3,4-dihydrochromene-6-carbonyl azide |
|---|---|
| PubChem CID | 143066121 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | ethane;2,2,4,8-tetramethyl-3,4-dihydrochromene-6-carbonyl azide |
| SMILES | CC.Cc1cc(C(=O)N=[N+]=[N-])cc2c1OC(C)(C)CC2C |
| InChI | InChI=1S/C14H17N3O2.C2H6/c1-8-5-10(13(18)16-17-15)6-11-9(2)7-14(3,4)19-12(8)11;1-2/h5-6,9H,7H2,1-4H3;1-2H3 |
| InChIKey | WFPOXQAZOCXFQA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|