C16H20O — CID 143065749
8-ethyl-6-ethynyl-2,2,4-trimethyl-3,4-dihydrochromene (PubChem CID 143065749) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 8-ethyl-6-ethynyl-2,2,4-trimethyl-3,4-dihydrochromene.
| Compound Name | 8-ethyl-6-ethynyl-2,2,4-trimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 143065749 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 8-ethyl-6-ethynyl-2,2,4-trimethyl-3,4-dihydrochromene |
| SMILES | C#Cc1cc(CC)c2c(c1)C(C)CC(C)(C)O2 |
| InChI | InChI=1S/C16H20O/c1-6-12-8-13(7-2)15-14(9-12)11(3)10-16(4,5)17-15/h1,8-9,11H,7,10H2,2-5H3 |
| InChIKey | AQSWVZKXGZJHJM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|