C14H20O2 — CID 154982719
7-ethyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol (PubChem CID 154982719) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 7-ethyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 7-ethyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 154982719 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 7-ethyl-2,2,4-trimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CCc1cc2c(cc1O)C(C)CC(C)(C)O2 |
| InChI | InChI=1S/C14H20O2/c1-5-10-6-13-11(7-12(10)15)9(2)8-14(3,4)16-13/h6-7,9,15H,5,8H2,1-4H3 |
| InChIKey | DADOMPDTSORWSR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |