About 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde
4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde (PubChem CID 144765187) has the molecular formula C20H22O3
and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde |
| PubChem CID | 144765187 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde |
| SMILES | CCc1cc2c(cc1-c1ccc(C=O)cc1)OC(C)(C)CC2O |
| InChI | InChI=1S/C20H22O3/c1-4-14-9-17-18(22)11-20(2,3)23-19(17)10-16(14)15-7-5-13(12-21)6-8-15/h5-10,12,18,22H,4,11H2,1-3H3 |
| InChIKey | OVUIKGNTBOGLDG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde?
The IUPAC name of 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde (CID 144765187) is 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde.
What is the SMILES notation for 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde?
The canonical SMILES for 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde is CCc1cc2c(cc1-c1ccc(C=O)cc1)OC(C)(C)CC2O.
What is the InChIKey of 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde?
The InChIKey is OVUIKGNTBOGLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O3/c1-4-14-9-17-18(22)11-20(2,3)23-19(17)10-16(14)15-7-5-13(12-21)6-8-15/h5-10,12,18,22H,4,11H2,1-3H3.
What are the key properties of 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde?
4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde has a molecular weight of 310.39 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-ethyl-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-7-yl)benzaldehyde is sourced from PubChem (CID 144765187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).