C27H44ClN3OS2 — CID 143074792
3-[1-[(E)-1-chloroprop-1-enyl]sulfanylethyl]-1-cyclohexyl-1-(1-phenylsulfanylpiperidin-4-yl)urea;ethane;ethene (PubChem CID 143074792) has the molecular formula C27H44ClN3OS2 and a molecular weight of 526.26 g/mol. Its IUPAC name is 3-[1-[(E)-1-chloroprop-1-enyl]sulfanylethyl]-1-cyclohexyl-1-(1-phenylsulfanylpiperidin-4-yl)urea;ethane;ethene.
| Compound Name | 3-[1-[(E)-1-chloroprop-1-enyl]sulfanylethyl]-1-cyclohexyl-1-(1-phenylsulfanylpiperidin-4-yl)urea;ethane;ethene |
|---|---|
| PubChem CID | 143074792 |
| Molecular Formula | C27H44ClN3OS2 |
| Molecular Weight | 526.26 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 3-[1-[(E)-1-chloroprop-1-enyl]sulfanylethyl]-1-cyclohexyl-1-(1-phenylsulfanylpiperidin-4-yl)urea;ethane;ethene |
| SMILES | C/C=C(/Cl)SC(C)NC(=O)N(C1CCCCC1)C1CCN(Sc2ccccc2)CC1.C=C.CC |
| InChI | InChI=1S/C23H34ClN3OS2.C2H6.C2H4/c1-3-22(24)29-18(2)25-23(28)27(19-10-6-4-7-11-19)20-14-16-26(17-15-20)30-21-12-8-5-9-13-21;2*1-2/h3,5,8-9,12-13,18-20H,4,6-7,10-11,14-17H2,1-2H3,(H,25,28);1-2H3;1-2H2/b22-3-;; |
| InChIKey | BYZDMEWKBIFOOV-SYIUOSAVSA-N |
| XLogP | 8.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.26 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|