C30H28FNO2 — CID 143077617
4-[(E)-3-[8-ethyl-8-methyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-iminoprop-1-enyl]-3-fluorobenzoic acid (PubChem CID 143077617) has the molecular formula C30H28FNO2 and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[(E)-3-[8-ethyl-8-methyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-iminoprop-1-enyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(E)-3-[8-ethyl-8-methyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-iminoprop-1-enyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 143077617 |
| Molecular Formula | C30H28FNO2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[(E)-3-[8-ethyl-8-methyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-iminoprop-1-enyl]-3-fluorobenzoic acid |
| SMILES | [H]/N=C(\C=C\c1ccc(C(=O)O)cc1F)c1ccc2c(c1)C(C)(CC)CC=C2c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28FNO2/c1-4-30(3)16-15-24(20-7-5-19(2)6-8-20)25-13-11-22(17-26(25)30)28(32)14-12-21-9-10-23(29(33)34)18-27(21)31/h5-15,17-18,32H,4,16H2,1-3H3,(H,33,34)/b14-12+,32-28+ |
| InChIKey | KIJFKINKDMITSK-VSYXWZFBSA-N |
| XLogP | 7.42 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|