C24H32N4O2 — CID 143081329
2-(4-butoxyphenyl)-5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole;N-methylmethanamine (PubChem CID 143081329) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole;N-methylmethanamine.
| Compound Name | 2-(4-butoxyphenyl)-5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole;N-methylmethanamine |
|---|---|
| PubChem CID | 143081329 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole;N-methylmethanamine |
| SMILES | CCCCOc1ccc(-c2nnc(-c3ccc(N4CCCC4)cc3)o2)cc1.CNC |
| InChI | InChI=1S/C22H25N3O2.C2H7N/c1-2-3-16-26-20-12-8-18(9-13-20)22-24-23-21(27-22)17-6-10-19(11-7-17)25-14-4-5-15-25;1-3-2/h6-13H,2-5,14-16H2,1H3;3H,1-2H3 |
| InChIKey | BITWIHOTBVUZSG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|