C26H44N4O2 — CID 143081422
3-[4-[4-[3-(4-butoxyphenyl)imidazolidin-1-yl]cyclohexyl]piperazin-1-yl]propan-1-ol (PubChem CID 143081422) has the molecular formula C26H44N4O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is 3-[4-[4-[3-(4-butoxyphenyl)imidazolidin-1-yl]cyclohexyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[4-[3-(4-butoxyphenyl)imidazolidin-1-yl]cyclohexyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 143081422 |
| Molecular Formula | C26H44N4O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | 3-[4-[4-[3-(4-butoxyphenyl)imidazolidin-1-yl]cyclohexyl]piperazin-1-yl]propan-1-ol |
| SMILES | CCCCOc1ccc(N2CCN(C3CCC(N4CCN(CCCO)CC4)CC3)C2)cc1 |
| InChI | InChI=1S/C26H44N4O2/c1-2-3-21-32-26-11-9-25(10-12-26)30-19-18-29(22-30)24-7-5-23(6-8-24)28-16-14-27(15-17-28)13-4-20-31/h9-12,23-24,31H,2-8,13-22H2,1H3 |
| InChIKey | HFKJKXFTPLTGSA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|