C12H19F3N2 — CID 143082490
(3Z,5E)-2,4,6-trifluoro-7-piperidin-4-ylhepta-3,5-dien-3-amine (PubChem CID 143082490) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is (3Z,5E)-2,4,6-trifluoro-7-piperidin-4-ylhepta-3,5-dien-3-amine.
| Compound Name | (3Z,5E)-2,4,6-trifluoro-7-piperidin-4-ylhepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 143082490 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (3Z,5E)-2,4,6-trifluoro-7-piperidin-4-ylhepta-3,5-dien-3-amine |
| SMILES | CC(F)/C(N)=C(F)\C=C(\F)CC1CCNCC1 |
| InChI | InChI=1S/C12H19F3N2/c1-8(13)12(16)11(15)7-10(14)6-9-2-4-17-5-3-9/h7-9,17H,2-6,16H2,1H3/b10-7+,12-11- |
| InChIKey | SIVUVWJHTAAYGE-GRHXWORQSA-N |
| XLogP | 2.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|