About 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one
2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 143083374) has the molecular formula C23H15F2IO5
and a molecular weight of 536.27 g/mol. Its IUPAC name is 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 143083374 |
| Molecular Formula | C23H15F2IO5 |
| Molecular Weight | 536.27 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COc1cc2c(cc1F)C1(OC(=O)c3ccccc31)c1cc(F)c(OC(C)I)cc1O2 |
| InChI | InChI=1S/C23H15F2IO5/c1-11(26)29-21-10-19-15(8-17(21)25)23(13-6-4-3-5-12(13)22(27)31-23)14-7-16(24)20(28-2)9-18(14)30-19/h3-11H,1-2H3 |
| InChIKey | OMHAIBUCLBBSGM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 143083374) is 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one is COc1cc2c(cc1F)C1(OC(=O)c3ccccc31)c1cc(F)c(OC(C)I)cc1O2.
What is the InChIKey of 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is OMHAIBUCLBBSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2IO5/c1-11(26)29-21-10-19-15(8-17(21)25)23(13-6-4-3-5-12(13)22(27)31-23)14-7-16(24)20(28-2)9-18(14)30-19/h3-11H,1-2H3.
What are the key properties of 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 536.27 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2',7'-difluoro-3'-(1-iodoethoxy)-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 143083374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).