C18H36N6O — CID 143087715
2-[[4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexyl]amino]ethanol;ethane (PubChem CID 143087715) has the molecular formula C18H36N6O and a molecular weight of 352.53 g/mol. Its IUPAC name is 2-[[4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexyl]amino]ethanol;ethane.
| Compound Name | 2-[[4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexyl]amino]ethanol;ethane |
|---|---|
| PubChem CID | 143087715 |
| Molecular Formula | C18H36N6O |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 2-[[4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexyl]amino]ethanol;ethane |
| SMILES | CC.CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCC(NCCO)CC1 |
| InChI | InChI=1S/C14H24N6O.2C2H6/c1-9(15)12-13(16)18-8-19-14(12)20-11-4-2-10(3-5-11)17-6-7-21;2*1-2/h8,10-11,15,17,21H,2-7H2,1H3,(H3,16,18,19,20);2*1-2H3/b15-9+;; |
| InChIKey | XBILMPJSOBVRIL-CBNWXSEKSA-N |
| XLogP | 2.80 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|