C18H30N6O2 — CID 143087727
ethane;3-[4-[[5-ethanimidoyl-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]-1,3-oxazolidin-2-one (PubChem CID 143087727) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is ethane;3-[4-[[5-ethanimidoyl-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;3-[4-[[5-ethanimidoyl-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143087727 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | ethane;3-[4-[[5-ethanimidoyl-6-(methylamino)pyrimidin-4-yl]amino]cyclohexyl]-1,3-oxazolidin-2-one |
| SMILES | CC.[H]/N=C(\C)c1c(NC)ncnc1NC1CCC(N2CCOC2=O)CC1 |
| InChI | InChI=1S/C16H24N6O2.C2H6/c1-10(17)13-14(18-2)19-9-20-15(13)21-11-3-5-12(6-4-11)22-7-8-24-16(22)23;1-2/h9,11-12,17H,3-8H2,1-2H3,(H2,18,19,20,21);1-2H3/b17-10+; |
| InChIKey | YMBXCULCJBMFMI-LZMXEPDESA-N |
| XLogP | 3.11 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|