C11H17NO — CID 143093994
4-amino-1-cyclohepta-1,3,5-trien-1-ylbutan-2-ol (PubChem CID 143093994) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-amino-1-cyclohepta-1,3,5-trien-1-ylbutan-2-ol.
| Compound Name | 4-amino-1-cyclohepta-1,3,5-trien-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 143093994 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-amino-1-cyclohepta-1,3,5-trien-1-ylbutan-2-ol |
| SMILES | NCCC(O)CC1=CC=CC=CC1 |
| InChI | InChI=1S/C11H17NO/c12-8-7-11(13)9-10-5-3-1-2-4-6-10/h1-5,11,13H,6-9,12H2 |
| InChIKey | SGHLADICIFDKAC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |