C10H17NO — CID 143110144
4-amino-1-cyclohexa-1,5-dien-1-ylbutan-2-ol (PubChem CID 143110144) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-amino-1-cyclohexa-1,5-dien-1-ylbutan-2-ol.
| Compound Name | 4-amino-1-cyclohexa-1,5-dien-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 143110144 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-amino-1-cyclohexa-1,5-dien-1-ylbutan-2-ol |
| SMILES | NCCC(O)CC1=CCCC=C1 |
| InChI | InChI=1S/C10H17NO/c11-7-6-10(12)8-9-4-2-1-3-5-9/h2,4-5,10,12H,1,3,6-8,11H2 |
| InChIKey | QQSGAWHBUYFIKF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |