C21H18N2O3S — CID 143098265
methyl 6-(cyclopropen-1-yl)-5-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 143098265) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl 6-(cyclopropen-1-yl)-5-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | methyl 6-(cyclopropen-1-yl)-5-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 143098265 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 6-(cyclopropen-1-yl)-5-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | COS(=O)(=O)c1ccc2c(/N=N/c3ccc(C)cc3)c(C3=CC3)ccc2c1 |
| InChI | InChI=1S/C21H18N2O3S/c1-14-3-8-17(9-4-14)22-23-21-19(15-5-6-15)11-7-16-13-18(10-12-20(16)21)27(24,25)26-2/h3-5,7-13H,6H2,1-2H3/b23-22+ |
| InChIKey | YXNLBOSAVQCDFL-GHVJWSGMSA-N |
| XLogP | 5.69 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|