C29H24N4O9S3 — CID 58234116
dimethyl 6-[(7-methoxysulfonyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate (PubChem CID 58234116) has the molecular formula C29H24N4O9S3 and a molecular weight of 668.73 g/mol. Its IUPAC name is dimethyl 6-[(7-methoxysulfonyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate.
| Compound Name | dimethyl 6-[(7-methoxysulfonyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 58234116 |
| Molecular Formula | C29H24N4O9S3 |
| Molecular Weight | 668.73 g/mol |
| Exact Mass | 668.07 |
| IUPAC Name | dimethyl 6-[(7-methoxysulfonyl-4-phenyldiazenylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonate |
| SMILES | COS(=O)(=O)c1cc(S(=O)(=O)OC)c2ccc(/N=N/c3ccc(/N=N/c4ccccc4)c4ccc(S(=O)(=O)OC)cc34)cc2c1 |
| InChI | InChI=1S/C29H24N4O9S3/c1-40-43(34,35)22-10-12-25-26(17-22)28(14-13-27(25)32-30-20-7-5-4-6-8-20)33-31-21-9-11-24-19(15-21)16-23(44(36,37)41-2)18-29(24)45(38,39)42-3/h4-18H,1-3H3/b32-30+,33-31+ |
| InChIKey | NJGRTPBGLPQIOJ-RRPBDJRISA-N |
| XLogP | 6.83 |
| TPSA | 179.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|