C32H40FNO4 — CID 143103991
ethyl 4-[4-[[3-[4-(2-ethoxyethoxymethyl)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluorobutanoate (PubChem CID 143103991) has the molecular formula C32H40FNO4 and a molecular weight of 521.67 g/mol. Its IUPAC name is ethyl 4-[4-[[3-[4-(2-ethoxyethoxymethyl)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluorobutanoate.
| Compound Name | ethyl 4-[4-[[3-[4-(2-ethoxyethoxymethyl)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluorobutanoate |
|---|---|
| PubChem CID | 143103991 |
| Molecular Formula | C32H40FNO4 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | ethyl 4-[4-[[3-[4-(2-ethoxyethoxymethyl)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2-fluorobutanoate |
| SMILES | CCOCCOCc1cc(C)c(-c2cccc(CNc3ccc(CCC(F)C(=O)OCC)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C32H40FNO4/c1-5-36-16-17-37-22-27-18-23(3)31(24(4)19-27)28-9-7-8-26(20-28)21-34-29-13-10-25(11-14-29)12-15-30(33)32(35)38-6-2/h7-11,13-14,18-20,30,34H,5-6,12,15-17,21-22H2,1-4H3 |
| InChIKey | KEFJGUCALNRNBF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|