C16H18O — CID 143109545
molecular hydrogen;1-[5-[(1S)-1-phenylethyl]cyclopenta-1,3-dien-1-yl]prop-2-en-1-one (PubChem CID 143109545) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is molecular hydrogen;1-[5-[(1S)-1-phenylethyl]cyclopenta-1,3-dien-1-yl]prop-2-en-1-one.
| Compound Name | molecular hydrogen;1-[5-[(1S)-1-phenylethyl]cyclopenta-1,3-dien-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143109545 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | molecular hydrogen;1-[5-[(1S)-1-phenylethyl]cyclopenta-1,3-dien-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1=CC=CC1[C@H](C)c1ccccc1.[H][H] |
| InChI | InChI=1S/C16H16O.H2/c1-3-16(17)15-11-7-10-14(15)12(2)13-8-5-4-6-9-13;/h3-12,14H,1H2,2H3;1H/t12-,14?;/m1./s1 |
| InChIKey | SPRKIACIRDKGBM-UYUUDJTFSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|