C10H11NO2 — CID 143125369
7-methyl-4,5-dihydro-1H-3,1-benzoxazepin-2-one (PubChem CID 143125369) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-methyl-4,5-dihydro-1H-3,1-benzoxazepin-2-one.
| Compound Name | 7-methyl-4,5-dihydro-1H-3,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 143125369 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7-methyl-4,5-dihydro-1H-3,1-benzoxazepin-2-one |
| SMILES | Cc1ccc2c(c1)CCOC(=O)N2 |
| InChI | InChI=1S/C10H11NO2/c1-7-2-3-9-8(6-7)4-5-13-10(12)11-9/h2-3,6H,4-5H2,1H3,(H,11,12) |
| InChIKey | RLBDSXHHOOKEED-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |