C17H29NO3 — CID 143129228
tert-butyl N-[2-[(3Z)-3-ethenylhexa-3,5-dienoxy]ethyl]-N-ethylcarbamate (PubChem CID 143129228) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(3Z)-3-ethenylhexa-3,5-dienoxy]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[(3Z)-3-ethenylhexa-3,5-dienoxy]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 143129228 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl N-[2-[(3Z)-3-ethenylhexa-3,5-dienoxy]ethyl]-N-ethylcarbamate |
| SMILES | C=C/C=C(\C=C)CCOCCN(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO3/c1-7-10-15(8-2)11-13-20-14-12-18(9-3)16(19)21-17(4,5)6/h7-8,10H,1-2,9,11-14H2,3-6H3/b15-10+ |
| InChIKey | ZVQJHBCZLMJKJV-XNTDXEJSSA-N |
| XLogP | 3.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|