C13H21NO — CID 143148144
(4E)-4-[(3E)-3-methoxyhexa-3,5-dien-2-ylidene]azepane (PubChem CID 143148144) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (4E)-4-[(3E)-3-methoxyhexa-3,5-dien-2-ylidene]azepane.
| Compound Name | (4E)-4-[(3E)-3-methoxyhexa-3,5-dien-2-ylidene]azepane |
|---|---|
| PubChem CID | 143148144 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (4E)-4-[(3E)-3-methoxyhexa-3,5-dien-2-ylidene]azepane |
| SMILES | C=C/C=C(OC)\C(C)=C1/CCCNCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-6-13(15-3)11(2)12-7-5-9-14-10-8-12/h4,6,14H,1,5,7-10H2,2-3H3/b12-11+,13-6+ |
| InChIKey | ZTWALFKXJRAWSA-KWKHWOPJSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|