C23H27N9 — CID 143149139
2-[5-[4-[(1E)-2-carbamimidoylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrrol-2-yl]-3H-benzimidazole-5-carboximidamide;ethane (PubChem CID 143149139) has the molecular formula C23H27N9 and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-[5-[4-[(1E)-2-carbamimidoylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrrol-2-yl]-3H-benzimidazole-5-carboximidamide;ethane.
| Compound Name | 2-[5-[4-[(1E)-2-carbamimidoylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrrol-2-yl]-3H-benzimidazole-5-carboximidamide;ethane |
|---|---|
| PubChem CID | 143149139 |
| Molecular Formula | C23H27N9 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[5-[4-[(1E)-2-carbamimidoylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrrol-2-yl]-3H-benzimidazole-5-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(N)/C(C=C)=C/c1nc(-c2ccc(-c3nc4ccc(/C(N)=N/[H])cc4[nH]3)[nH]2)[nH]c1C |
| InChI | InChI=1S/C21H21N9.C2H6/c1-3-11(18(22)23)8-16-10(2)26-20(29-16)14-6-7-15(27-14)21-28-13-5-4-12(19(24)25)9-17(13)30-21;1-2/h3-9,27H,1H2,2H3,(H3,22,23)(H3,24,25)(H,26,29)(H,28,30);1-2H3/b11-8+; |
| InChIKey | NLQVOWBGONKITP-YGCVIUNWSA-N |
| XLogP | 4.07 |
| TPSA | 172.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|