C17H16 — CID 143151885
tetracyclo[7.6.2.04,17.012,16]heptadeca-1(16),2,4(17),8,12,14-hexaene (PubChem CID 143151885) has the molecular formula C17H16 and a molecular weight of 220.32 g/mol. Its IUPAC name is tetracyclo[7.6.2.04,17.012,16]heptadeca-1(16),2,4(17),8,12,14-hexaene.
| Compound Name | tetracyclo[7.6.2.04,17.012,16]heptadeca-1(16),2,4(17),8,12,14-hexaene |
|---|---|
| PubChem CID | 143151885 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | tetracyclo[7.6.2.04,17.012,16]heptadeca-1(16),2,4(17),8,12,14-hexaene |
| SMILES | C1=C2CCc3cccc4ccc(c2c34)CCC1 |
| InChI | InChI=1S/C17H16/c1-2-5-13-9-11-15-7-3-6-14-10-8-12(4-1)16(13)17(14)15/h3-4,6-7,9,11H,1-2,5,8,10H2 |
| InChIKey | RZLPRPASQPRBCI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |