C19H27N3O4 — CID 143155278
4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxobutanal;(Z)-N-methyl-2-methyliminopent-3-en-1-amine (PubChem CID 143155278) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxobutanal;(Z)-N-methyl-2-methyliminopent-3-en-1-amine.
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxobutanal;(Z)-N-methyl-2-methyliminopent-3-en-1-amine |
|---|---|
| PubChem CID | 143155278 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxobutanal;(Z)-N-methyl-2-methyliminopent-3-en-1-amine |
| SMILES | C/C=C\C(CNC)=N/C.O=CC(O)C(O)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO4.C7H14N2/c14-7-10(15)11(16)12(17)13-5-8-3-1-2-4-9(8)6-13;1-4-5-7(9-3)6-8-2/h1-4,7,10-11,15-16H,5-6H2;4-5,8H,6H2,1-3H3/b;5-4-,9-7+ |
| InChIKey | CYAPVSIYDHCUHK-CNXQNFLESA-N |
| XLogP | 0.30 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|