C30H39N7O3 — CID 143158641
ethane;methoxyethane;2-[[4-(N'-methylcarbamimidoyl)anilino]methyl]-N-(3-oxopropyl)-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide (PubChem CID 143158641) has the molecular formula C30H39N7O3 and a molecular weight of 545.69 g/mol. Its IUPAC name is ethane;methoxyethane;2-[[4-(N'-methylcarbamimidoyl)anilino]methyl]-N-(3-oxopropyl)-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | ethane;methoxyethane;2-[[4-(N'-methylcarbamimidoyl)anilino]methyl]-N-(3-oxopropyl)-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143158641 |
| Molecular Formula | C30H39N7O3 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | ethane;methoxyethane;2-[[4-(N'-methylcarbamimidoyl)anilino]methyl]-N-(3-oxopropyl)-N-pyridin-2-yl-3H-benzimidazole-5-carboxamide |
| SMILES | C/N=C(\N)c1ccc(NCc2nc3ccc(C(=O)N(CCC=O)c4ccccn4)cc3[nH]2)cc1.CC.CCOC |
| InChI | InChI=1S/C25H25N7O2.C3H8O.C2H6/c1-27-24(26)17-6-9-19(10-7-17)29-16-22-30-20-11-8-18(15-21(20)31-22)25(34)32(13-4-14-33)23-5-2-3-12-28-23;1-3-4-2;1-2/h2-3,5-12,14-15,29H,4,13,16H2,1H3,(H2,26,27)(H,30,31);3H2,1-2H3;1-2H3 |
| InChIKey | VUBIYHINSYRLIF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|