C23H34F3N5O2S — CID 143160227
5-[(E)-but-1-enyl]-13-(dimethylamino)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane;3-(trifluoromethoxy)but-1-ene (PubChem CID 143160227) has the molecular formula C23H34F3N5O2S and a molecular weight of 501.62 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-13-(dimethylamino)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane;3-(trifluoromethoxy)but-1-ene.
| Compound Name | 5-[(E)-but-1-enyl]-13-(dimethylamino)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane;3-(trifluoromethoxy)but-1-ene |
|---|---|
| PubChem CID | 143160227 |
| Molecular Formula | C23H34F3N5O2S |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 5-[(E)-but-1-enyl]-13-(dimethylamino)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane;3-(trifluoromethoxy)but-1-ene |
| SMILES | C=CC(C)OC(F)(F)F.CC.CC.CC/C=C/n1cnc2c(sc3ncnc(N(C)C)c32)c1=O |
| InChI | InChI=1S/C14H15N5OS.C5H7F3O.2C2H6/c1-4-5-6-19-8-17-10-9-12(18(2)3)15-7-16-13(9)21-11(10)14(19)20;1-3-4(2)9-5(6,7)8;2*1-2/h5-8H,4H2,1-3H3;3-4H,1H2,2H3;2*1-2H3/b6-5+;;; |
| InChIKey | GTDDDTLWCASWHI-FWMLTEASSA-N |
| XLogP | 6.50 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|