C24H27NO — CID 143167844
4-(4-tert-butyl-2,3-dimethylphenyl)-5-phenyl-2-prop-2-enyl-1,3-oxazole (PubChem CID 143167844) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-(4-tert-butyl-2,3-dimethylphenyl)-5-phenyl-2-prop-2-enyl-1,3-oxazole.
| Compound Name | 4-(4-tert-butyl-2,3-dimethylphenyl)-5-phenyl-2-prop-2-enyl-1,3-oxazole |
|---|---|
| PubChem CID | 143167844 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 4-(4-tert-butyl-2,3-dimethylphenyl)-5-phenyl-2-prop-2-enyl-1,3-oxazole |
| SMILES | C=CCc1nc(-c2ccc(C(C)(C)C)c(C)c2C)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H27NO/c1-7-11-21-25-22(23(26-21)18-12-9-8-10-13-18)19-14-15-20(24(4,5)6)17(3)16(19)2/h7-10,12-15H,1,11H2,2-6H3 |
| InChIKey | YMEIYLLBTOACSH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|