C14H16INO4 — CID 143169896
(3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2-iodophenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 143169896) has the molecular formula C14H16INO4 and a molecular weight of 389.19 g/mol. Its IUPAC name is (3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2-iodophenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2-iodophenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 143169896 |
| Molecular Formula | C14H16INO4 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2-iodophenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | C[C@@H]1OC(=O)[C@@H]2[C@H]1C(CO)ON2Cc1ccccc1I |
| InChI | InChI=1S/C14H16INO4/c1-8-12-11(7-17)20-16(13(12)14(18)19-8)6-9-4-2-3-5-10(9)15/h2-5,8,11-13,17H,6-7H2,1H3/t8-,11?,12+,13-/m0/s1 |
| InChIKey | QBVQKEAGSSGVHS-WZOJZANDSA-N |
| XLogP | 1.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|