C17H13NO4 — CID 143179282
3-oxo-6-(2-phenylethenyl)-1,4-benzoxazine-4-carboxylic acid (PubChem CID 143179282) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-oxo-6-(2-phenylethenyl)-1,4-benzoxazine-4-carboxylic acid.
| Compound Name | 3-oxo-6-(2-phenylethenyl)-1,4-benzoxazine-4-carboxylic acid |
|---|---|
| PubChem CID | 143179282 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-oxo-6-(2-phenylethenyl)-1,4-benzoxazine-4-carboxylic acid |
| SMILES | O=C(O)N1C(=O)COc2ccc(C=Cc3ccccc3)cc21 |
| InChI | InChI=1S/C17H13NO4/c19-16-11-22-15-9-8-13(10-14(15)18(16)17(20)21)7-6-12-4-2-1-3-5-12/h1-10H,11H2,(H,20,21) |
| InChIKey | SUHDDEGASYAPBT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|