C21H29N3 — CID 143185592
(2Z,4E,6E,8Z)-7-amino-2-[(2Z,4E)-4-(butylamino)hepta-2,4,6-trien-3-yl]deca-2,4,6,8-tetraenenitrile (PubChem CID 143185592) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is (2Z,4E,6E,8Z)-7-amino-2-[(2Z,4E)-4-(butylamino)hepta-2,4,6-trien-3-yl]deca-2,4,6,8-tetraenenitrile.
| Compound Name | (2Z,4E,6E,8Z)-7-amino-2-[(2Z,4E)-4-(butylamino)hepta-2,4,6-trien-3-yl]deca-2,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 143185592 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | (2Z,4E,6E,8Z)-7-amino-2-[(2Z,4E)-4-(butylamino)hepta-2,4,6-trien-3-yl]deca-2,4,6,8-tetraenenitrile |
| SMILES | C=C/C=C(NCCCC)/C(=C\C)C(/C#N)=C/C=C/C=C(N)\C=C/C |
| InChI | InChI=1S/C21H29N3/c1-5-9-16-24-21(13-7-3)20(8-4)18(17-22)14-10-11-15-19(23)12-6-2/h6-8,10-15,24H,3,5,9,16,23H2,1-2,4H3/b11-10+,12-6-,18-14+,19-15+,20-8-,21-13+ |
| InChIKey | ZLRAPPQJHJWXJT-IVPWUIQJSA-N |
| XLogP | 4.82 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|