About acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one
acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one (PubChem CID 143186284) has the molecular formula C13H16N2O5S
and a molecular weight of 312.35 g/mol. Its IUPAC name is acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one.
Molecular Properties
| Compound Name | acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one |
| PubChem CID | 143186284 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one |
| SMILES | CC(=O)O.Cc1ccc(S(=O)(=O)N2C=CNC(=O)C2)cc1 |
| InChI | InChI=1S/C11H12N2O3S.C2H4O2/c1-9-2-4-10(5-3-9)17(15,16)13-7-6-12-11(14)8-13;1-2(3)4/h2-7H,8H2,1H3,(H,12,14);1H3,(H,3,4) |
| InChIKey | QDSHNUFASGNVME-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one?
The IUPAC name of acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one (CID 143186284) is acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one.
What is the SMILES notation for acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one?
The canonical SMILES for acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one is CC(=O)O.Cc1ccc(S(=O)(=O)N2C=CNC(=O)C2)cc1.
What is the InChIKey of acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one?
The InChIKey is QDSHNUFASGNVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S.C2H4O2/c1-9-2-4-10(5-3-9)17(15,16)13-7-6-12-11(14)8-13;1-2(3)4/h2-7H,8H2,1H3,(H,12,14);1H3,(H,3,4).
What are the key properties of acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one?
acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one has a molecular weight of 312.35 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-(4-methylphenyl)sulfonyl-1,3-dihydropyrazin-2-one is sourced from PubChem (CID 143186284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).