C27H44O2 — CID 143190708
cyclohepta-1,4,6-trien-1-yl-(1-undec-10-enoxycyclohexyl)methanone;ethane (PubChem CID 143190708) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-yl-(1-undec-10-enoxycyclohexyl)methanone;ethane.
| Compound Name | cyclohepta-1,4,6-trien-1-yl-(1-undec-10-enoxycyclohexyl)methanone;ethane |
|---|---|
| PubChem CID | 143190708 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-yl-(1-undec-10-enoxycyclohexyl)methanone;ethane |
| SMILES | C=CCCCCCCCCCOC1(C(=O)C2=CCC=CC=C2)CCCCC1.CC |
| InChI | InChI=1S/C25H38O2.C2H6/c1-2-3-4-5-6-7-8-11-17-22-27-25(20-15-12-16-21-25)24(26)23-18-13-9-10-14-19-23;1-2/h2,9-10,13,18-19H,1,3-8,11-12,14-17,20-22H2;1-2H3 |
| InChIKey | BAAYFPCPTCBKOZ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|