C9H14O2 — CID 143193856
4-methyl-5-[(Z)-3-methylbut-1-enyl]-1,3-dioxole (PubChem CID 143193856) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-methyl-5-[(Z)-3-methylbut-1-enyl]-1,3-dioxole.
| Compound Name | 4-methyl-5-[(Z)-3-methylbut-1-enyl]-1,3-dioxole |
|---|---|
| PubChem CID | 143193856 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 4-methyl-5-[(Z)-3-methylbut-1-enyl]-1,3-dioxole |
| SMILES | CC1=C(/C=C\C(C)C)OCO1 |
| InChI | InChI=1S/C9H14O2/c1-7(2)4-5-9-8(3)10-6-11-9/h4-5,7H,6H2,1-3H3/b5-4- |
| InChIKey | PHEVADHRRAAYAP-PLNGDYQASA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |