C7H9NO2 — CID 145064608
(Z)-N-(5-ethenyl-1,3-dioxol-4-yl)ethanimine (PubChem CID 145064608) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (Z)-N-(5-ethenyl-1,3-dioxol-4-yl)ethanimine.
| Compound Name | (Z)-N-(5-ethenyl-1,3-dioxol-4-yl)ethanimine |
|---|---|
| PubChem CID | 145064608 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (Z)-N-(5-ethenyl-1,3-dioxol-4-yl)ethanimine |
| SMILES | C=CC1=C(/N=C\C)OCO1 |
| InChI | InChI=1S/C7H9NO2/c1-3-6-7(8-4-2)10-5-9-6/h3-4H,1,5H2,2H3/b8-4- |
| InChIKey | RCUQTZUUOIGODA-YWEYNIOJSA-N |
| XLogP | 1.44 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|