C24H34O2 — CID 143197118
(7R,8R,9S,13S)-7-ethyl-13,15-dimethyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 143197118) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (7R,8R,9S,13S)-7-ethyl-13,15-dimethyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (7R,8R,9S,13S)-7-ethyl-13,15-dimethyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 143197118 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (7R,8R,9S,13S)-7-ethyl-13,15-dimethyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCCOc1ccc2c(c1)C[C@@H](CC)[C@H]1C3C(C)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C24H34O2/c1-5-11-26-18-7-8-19-17(14-18)13-16(6-2)22-20(19)9-10-24(4)21(25)12-15(3)23(22)24/h7-8,14-16,20,22-23H,5-6,9-13H2,1-4H3/t15?,16-,20-,22-,23?,24-/m1/s1 |
| InChIKey | KOMLFHWSPLWLOU-GBOLKTQPSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |