C22H38O4 — CID 143206822
methyl 7-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate;propane-2,2-diol (PubChem CID 143206822) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is methyl 7-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate;propane-2,2-diol.
| Compound Name | methyl 7-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate;propane-2,2-diol |
|---|---|
| PubChem CID | 143206822 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | methyl 7-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate;propane-2,2-diol |
| SMILES | CC(C)(O)O.COC(=O)CCCCCC[C@H]1C(C)C=CC2=CCCCC21 |
| InChI | InChI=1S/C19H30O2.C3H8O2/c1-15-13-14-16-9-7-8-11-18(16)17(15)10-5-3-4-6-12-19(20)21-2;1-3(2,4)5/h9,13-15,17-18H,3-8,10-12H2,1-2H3;4-5H,1-2H3/t15?,17-,18?;/m0./s1 |
| InChIKey | DUBJWNVAXRPFMK-ZKKSDTLWSA-N |
| XLogP | 4.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|