C36H52O5 — CID 142112452
[(2R)-2-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]-6-oxooxan-4-yl] 3-hydroxy-7-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoate (PubChem CID 142112452) has the molecular formula C36H52O5 and a molecular weight of 564.81 g/mol. Its IUPAC name is [(2R)-2-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]-6-oxooxan-4-yl] 3-hydroxy-7-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoate.
| Compound Name | [(2R)-2-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]-6-oxooxan-4-yl] 3-hydroxy-7-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoate |
|---|---|
| PubChem CID | 142112452 |
| Molecular Formula | C36H52O5 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | [(2R)-2-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]-6-oxooxan-4-yl] 3-hydroxy-7-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoate |
| SMILES | CC1C=CC2=CCCCC2C1CCCCC(O)CC(=O)OC1CC(=O)O[C@H](CCC2C(C)C=CC3=CCCCC32)C1 |
| InChI | InChI=1S/C36H52O5/c1-24-15-17-26-9-3-6-13-33(26)31(24)12-8-5-11-28(37)21-35(38)41-30-22-29(40-36(39)23-30)19-20-32-25(2)16-18-27-10-4-7-14-34(27)32/h9-10,15-18,24-25,28-34,37H,3-8,11-14,19-23H2,1-2H3/t24?,25?,28?,29-,30?,31?,32?,33?,34?/m1/s1 |
| InChIKey | PIBWOXRHOIRQBY-GAKXCMIPSA-N |
| XLogP | 7.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|