C21H34O2 — CID 143206823
ethene;8-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]octanoic acid (PubChem CID 143206823) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is ethene;8-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]octanoic acid.
| Compound Name | ethene;8-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]octanoic acid |
|---|---|
| PubChem CID | 143206823 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | ethene;8-[(1S)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]octanoic acid |
| SMILES | C=C.CC1C=CC2=CCCCC2[C@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C19H30O2.C2H4/c1-15-13-14-16-9-7-8-11-18(16)17(15)10-5-3-2-4-6-12-19(20)21;1-2/h9,13-15,17-18H,2-8,10-12H2,1H3,(H,20,21);1-2H2/t15?,17-,18?;/m0./s1 |
| InChIKey | DUCSDOJPGSEJHH-ZKKSDTLWSA-N |
| XLogP | 6.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|