C7H7N2O3+ — CID 143207420
[(6Z)-3-formyl-6-hydroperoxyiminocyclohexa-2,4-dien-1-ylidene]azanium (PubChem CID 143207420) has the molecular formula C7H7N2O3+ and a molecular weight of 167.14 g/mol. Its IUPAC name is [(6Z)-3-formyl-6-hydroperoxyiminocyclohexa-2,4-dien-1-ylidene]azanium.
| Compound Name | [(6Z)-3-formyl-6-hydroperoxyiminocyclohexa-2,4-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 143207420 |
| Molecular Formula | C7H7N2O3+ |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | [(6Z)-3-formyl-6-hydroperoxyiminocyclohexa-2,4-dien-1-ylidene]azanium |
| SMILES | [NH2+]=C1C=C(C=O)C=C/C1=N/OO |
| InChI | InChI=1S/C7H6N2O3/c8-6-3-5(4-10)1-2-7(6)9-12-11/h1-4,8,11H/p+1/b8-6?,9-7- |
| InChIKey | IGLCRMUCVNGJFC-FRYQIGRPSA-O |
| XLogP | -1.27 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|