C9H13NO — CID 143209004
1-but-1-en-2-yl-3,4-dihydropyridin-2-one (PubChem CID 143209004) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-but-1-en-2-yl-3,4-dihydropyridin-2-one.
| Compound Name | 1-but-1-en-2-yl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 143209004 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-but-1-en-2-yl-3,4-dihydropyridin-2-one |
| SMILES | C=C(CC)N1C=CCCC1=O |
| InChI | InChI=1S/C9H13NO/c1-3-8(2)10-7-5-4-6-9(10)11/h5,7H,2-4,6H2,1H3 |
| InChIKey | YHFIVMMUXFMJSL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |