C12H21N3 — CID 143209033
ethane;3-hexa-4,5-dienyl-4,5-dimethyl-1,2,4-triazole (PubChem CID 143209033) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;3-hexa-4,5-dienyl-4,5-dimethyl-1,2,4-triazole.
| Compound Name | ethane;3-hexa-4,5-dienyl-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143209033 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;3-hexa-4,5-dienyl-4,5-dimethyl-1,2,4-triazole |
| SMILES | C=C=CCCCc1nnc(C)n1C.CC |
| InChI | InChI=1S/C10H15N3.C2H6/c1-4-5-6-7-8-10-12-11-9(2)13(10)3;1-2/h5H,1,6-8H2,2-3H3;1-2H3 |
| InChIKey | ISLADNXAEBBWHV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|