C21H24Cl2N2O2 — CID 143209870
6-[4-[2-(2,3-dichloroanilino)ethylamino]butoxy]-2,3-dihydroinden-1-one (PubChem CID 143209870) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 6-[4-[2-(2,3-dichloroanilino)ethylamino]butoxy]-2,3-dihydroinden-1-one.
| Compound Name | 6-[4-[2-(2,3-dichloroanilino)ethylamino]butoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 143209870 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 6-[4-[2-(2,3-dichloroanilino)ethylamino]butoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(OCCCCNCCNc3cccc(Cl)c3Cl)cc21 |
| InChI | InChI=1S/C21H24Cl2N2O2/c22-18-4-3-5-19(21(18)23)25-12-11-24-10-1-2-13-27-16-8-6-15-7-9-20(26)17(15)14-16/h3-6,8,14,24-25H,1-2,7,9-13H2 |
| InChIKey | SOSXBOKGVLQEGI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|