C13H9N7O — CID 143210826
pteridine;3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 143210826) has the molecular formula C13H9N7O and a molecular weight of 279.26 g/mol. Its IUPAC name is pteridine;3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | pteridine;3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 143210826 |
| Molecular Formula | C13H9N7O |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | pteridine;3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2cccnc12.c1cnc2ncncc2n1 |
| InChI | InChI=1S/C7H5N3O.C6H4N4/c11-7-6-5(9-4-10-7)2-1-3-8-6;1-2-9-6-5(8-1)3-7-4-10-6/h1-4H,(H,9,10,11);1-4H |
| InChIKey | LRBNRQBWHSPAGJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |