C38H37F3N2O5 — CID 143216302
[2-ethoxy-4-(1-methoxyethenyl)phenyl] 4-[3-(methylcarbamoyl)-4-[1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]phenyl]butanoate (PubChem CID 143216302) has the molecular formula C38H37F3N2O5 and a molecular weight of 658.72 g/mol. Its IUPAC name is [2-ethoxy-4-(1-methoxyethenyl)phenyl] 4-[3-(methylcarbamoyl)-4-[1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]phenyl]butanoate.
| Compound Name | [2-ethoxy-4-(1-methoxyethenyl)phenyl] 4-[3-(methylcarbamoyl)-4-[1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]phenyl]butanoate |
|---|---|
| PubChem CID | 143216302 |
| Molecular Formula | C38H37F3N2O5 |
| Molecular Weight | 658.72 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | [2-ethoxy-4-(1-methoxyethenyl)phenyl] 4-[3-(methylcarbamoyl)-4-[1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]phenyl]butanoate |
| SMILES | C=C(OC)c1ccc(OC(=O)CCCc2ccc(NC(=C)c3ccccc3-c3ccc(C(F)(F)F)cc3)c(C(=O)NC)c2)c(OCC)c1 |
| InChI | InChI=1S/C38H37F3N2O5/c1-6-47-35-23-28(25(3)46-5)17-21-34(35)48-36(44)13-9-10-26-14-20-33(32(22-26)37(45)42-4)43-24(2)30-11-7-8-12-31(30)27-15-18-29(19-16-27)38(39,40)41/h7-8,11-12,14-23,43H,2-3,6,9-10,13H2,1,4-5H3,(H,42,45) |
| InChIKey | MUUVWLZEEXUWOJ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.72 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|