C14H10NO4+ — CID 143220049
8-hydroxy-2-(4-hydroxyphenyl)pyrano[2,3-b]pyridin-8-ium-4-one (PubChem CID 143220049) has the molecular formula C14H10NO4+ and a molecular weight of 256.24 g/mol. Its IUPAC name is 8-hydroxy-2-(4-hydroxyphenyl)pyrano[2,3-b]pyridin-8-ium-4-one.
| Compound Name | 8-hydroxy-2-(4-hydroxyphenyl)pyrano[2,3-b]pyridin-8-ium-4-one |
|---|---|
| PubChem CID | 143220049 |
| Molecular Formula | C14H10NO4+ |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 8-hydroxy-2-(4-hydroxyphenyl)pyrano[2,3-b]pyridin-8-ium-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c1ccc[n+]2O |
| InChI | InChI=1S/C14H9NO4/c16-10-5-3-9(4-6-10)13-8-12(17)11-2-1-7-15(18)14(11)19-13/h1-8H,(H-,16,17,18)/p+1 |
| InChIKey | KFXQLEDGOUCMFF-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|