C26H33NO8 — CID 143231075
1-O-benzyl 5-O-[2-(2-hydroxypropoxy)propyl] 2-(phenylmethoxycarbonylamino)pentanedioate (PubChem CID 143231075) has the molecular formula C26H33NO8 and a molecular weight of 487.55 g/mol. Its IUPAC name is 1-O-benzyl 5-O-[2-(2-hydroxypropoxy)propyl] 2-(phenylmethoxycarbonylamino)pentanedioate.
| Compound Name | 1-O-benzyl 5-O-[2-(2-hydroxypropoxy)propyl] 2-(phenylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 143231075 |
| Molecular Formula | C26H33NO8 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 1-O-benzyl 5-O-[2-(2-hydroxypropoxy)propyl] 2-(phenylmethoxycarbonylamino)pentanedioate |
| SMILES | CC(O)COC(C)COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO8/c1-19(28)15-32-20(2)16-33-24(29)14-13-23(25(30)34-17-21-9-5-3-6-10-21)27-26(31)35-18-22-11-7-4-8-12-22/h3-12,19-20,23,28H,13-18H2,1-2H3,(H,27,31) |
| InChIKey | ZFBAVXJKDJBGQT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|