C25H29NO8 — CID 88562457
1-O-benzyl 5-O-butan-2-yloxycarbonyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (PubChem CID 88562457) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is 1-O-benzyl 5-O-butan-2-yloxycarbonyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate.
| Compound Name | 1-O-benzyl 5-O-butan-2-yloxycarbonyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 88562457 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 1-O-benzyl 5-O-butan-2-yloxycarbonyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
| SMILES | CCC(C)OC(=O)OC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO8/c1-3-18(2)33-25(30)34-22(27)15-14-21(23(28)31-16-19-10-6-4-7-11-19)26-24(29)32-17-20-12-8-5-9-13-20/h4-13,18,21H,3,14-17H2,1-2H3,(H,26,29)/t18?,21-/m0/s1 |
| InChIKey | UACUIYNOGZWHIR-ZYZRXSCRSA-N |
| XLogP | 4.28 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|