C22H19Cl2IN4O4S — CID 143233936
(S)-3-(3-aminopropoxy)-4-[[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamoyl]benzenesulfinyl iodide (PubChem CID 143233936) has the molecular formula C22H19Cl2IN4O4S and a molecular weight of 633.30 g/mol. Its IUPAC name is (S)-3-(3-aminopropoxy)-4-[[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamoyl]benzenesulfinyl iodide.
| Compound Name | (S)-3-(3-aminopropoxy)-4-[[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamoyl]benzenesulfinyl iodide |
|---|---|
| PubChem CID | 143233936 |
| Molecular Formula | C22H19Cl2IN4O4S |
| Molecular Weight | 633.30 g/mol |
| Exact Mass | 631.95 |
| IUPAC Name | (S)-3-(3-aminopropoxy)-4-[[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamoyl]benzenesulfinyl iodide |
| SMILES | NCCCOc1cc([S@@](=O)I)ccc1C(=O)Nc1ccc(Cl)cc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C22H19Cl2IN4O4S/c23-13-2-6-18(17(10-13)22(31)29-20-7-3-14(24)12-27-20)28-21(30)16-5-4-15(34(25)32)11-19(16)33-9-1-8-26/h2-7,10-12H,1,8-9,26H2,(H,28,30)(H,27,29,31)/t34-/m1/s1 |
| InChIKey | DWSWEIGZELABPD-UUWRZZSWSA-N |
| XLogP | 5.08 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|