C10H12N2 — CID 143248711
5,5-dimethyl-1H-pyrrolo[2,3-c]azepine (PubChem CID 143248711) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 5,5-dimethyl-1H-pyrrolo[2,3-c]azepine.
| Compound Name | 5,5-dimethyl-1H-pyrrolo[2,3-c]azepine |
|---|---|
| PubChem CID | 143248711 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5,5-dimethyl-1H-pyrrolo[2,3-c]azepine |
| SMILES | CC1(C)C=NC=c2[nH]ccc2=C1 |
| InChI | InChI=1S/C10H12N2/c1-10(2)5-8-3-4-12-9(8)6-11-7-10/h3-7,12H,1-2H3 |
| InChIKey | QECBKWINTWKQBV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |