About acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol
acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol (PubChem CID 143258843) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol.
Molecular Properties
| Compound Name | acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol |
| PubChem CID | 143258843 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol |
| SMILES | C#C.C=C(/C=C\CO)CCNC |
| InChI | InChI=1S/C8H15NO.C2H2/c1-8(4-3-7-10)5-6-9-2;1-2/h3-4,9-10H,1,5-7H2,2H3;1-2H/b4-3-; |
| InChIKey | VPTFOTHFRRLIHX-LNKPDPKZSA-N |
| XLogP | 0.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol?
The IUPAC name of acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol (CID 143258843) is acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol.
What is the SMILES notation for acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol?
The canonical SMILES for acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol is C#C.C=C(/C=C\CO)CCNC.
What is the InChIKey of acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol?
The InChIKey is VPTFOTHFRRLIHX-LNKPDPKZSA-N. The full InChI is InChI=1S/C8H15NO.C2H2/c1-8(4-3-7-10)5-6-9-2;1-2/h3-4,9-10H,1,5-7H2,2H3;1-2H/b4-3-;.
What are the key properties of acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol?
acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol has a molecular weight of 167.25 g/mol, XLogP of 0.95, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(Z)-6-(methylamino)-4-methylidenehex-2-en-1-ol is sourced from PubChem (CID 143258843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).